C18H31N3O3S — CID 111634870
1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[(3-methoxyphenyl)methyl]guanidine (PubChem CID 111634870) has the molecular formula C18H31N3O3S and a molecular weight of 369.53 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[(3-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[(3-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111634870 |
| Molecular Formula | C18H31N3O3S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-3-ethyl-2-[(3-methoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1)NCC(C)(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C18H31N3O3S/c1-6-19-17(20-13-15-8-7-9-16(12-15)24-4)21-14-18(2,3)10-11-25(5,22)23/h7-9,12H,6,10-11,13-14H2,1-5H3,(H2,19,20,21) |
| InChIKey | VGQDENDAUKYJOF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|