C18H39IN4O3S — CID 111634884
1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111634884) has the molecular formula C18H39IN4O3S and a molecular weight of 518.51 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111634884 |
| Molecular Formula | C18H39IN4O3S |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1CN(CC(C)C)CCO1)NCC(C)(C)CCS(C)(=O)=O.I |
| InChI | InChI=1S/C18H38N4O3S.HI/c1-15(2)12-22-8-9-25-16(13-22)11-20-17(19-5)21-14-18(3,4)7-10-26(6,23)24;/h15-16H,7-14H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | PUGQHLVVVBRDLK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|