C18H28O4Si — CID 11163502
diethyl 4-methylidene-6-trimethylsilyl-1,3,3a,5-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 11163502) has the molecular formula C18H28O4Si and a molecular weight of 336.50 g/mol. Its IUPAC name is diethyl 4-methylidene-6-trimethylsilyl-1,3,3a,5-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | diethyl 4-methylidene-6-trimethylsilyl-1,3,3a,5-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11163502 |
| Molecular Formula | C18H28O4Si |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | diethyl 4-methylidene-6-trimethylsilyl-1,3,3a,5-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | C=C1CC([Si](C)(C)C)=C2CC(C(=O)OCC)(C(=O)OCC)CC12 |
| InChI | InChI=1S/C18H28O4Si/c1-7-21-16(19)18(17(20)22-8-2)10-13-12(3)9-15(14(13)11-18)23(4,5)6/h13H,3,7-11H2,1-2,4-6H3 |
| InChIKey | FICFTECZBTZCIG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|