C22H28ClN7 — CID 111637806
1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111637806) has the molecular formula C22H28ClN7 and a molecular weight of 425.97 g/mol. Its IUPAC name is 1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111637806 |
| Molecular Formula | C22H28ClN7 |
| Molecular Weight | 425.97 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCc1nnc2ccccn12)NCC1CCCN(C)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H28ClN7/c1-24-22(26-15-20-28-27-19-10-3-4-12-30(19)20)25-14-17-8-6-11-29(2)21(17)16-7-5-9-18(23)13-16/h3-5,7,9-10,12-13,17,21H,6,8,11,14-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | BYBGMZCDSILSME-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.97 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|