C19H29ClIN7 — CID 111637659
1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-2-methyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111637659) has the molecular formula C19H29ClIN7 and a molecular weight of 517.85 g/mol. Its IUPAC name is 1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-2-methyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-2-methyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111637659 |
| Molecular Formula | C19H29ClIN7 |
| Molecular Weight | 517.85 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-2-methyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nncn1C)NCC1CCCN(C)C1c1cccc(Cl)c1.I |
| InChI | InChI=1S/C19H28ClN7.HI/c1-21-19(23-12-17-25-24-13-27(17)3)22-11-15-7-5-9-26(2)18(15)14-6-4-8-16(20)10-14;/h4,6,8,10,13,15,18H,5,7,9,11-12H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | PIPLKTUDJWBHRY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.85 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|