C22H33ClIN5S — CID 111637715
1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111637715) has the molecular formula C22H33ClIN5S and a molecular weight of 561.97 g/mol. Its IUPAC name is 1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111637715 |
| Molecular Formula | C22H33ClIN5S |
| Molecular Weight | 561.97 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nc(CCN/C(=N\C)NCC2CCCN(C)C2c2cccc(Cl)c2)cs1.I |
| InChI | InChI=1S/C22H32ClN5S.HI/c1-4-20-27-19(15-29-20)10-11-25-22(24-2)26-14-17-8-6-12-28(3)21(17)16-7-5-9-18(23)13-16;/h5,7,9,13,15,17,21H,4,6,8,10-12,14H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | PREMHLSUTHFVSD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.97 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|