C20H31ClF3IN4O — CID 111637609
1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111637609) has the molecular formula C20H31ClF3IN4O and a molecular weight of 562.85 g/mol. Its IUPAC name is 1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111637609 |
| Molecular Formula | C20H31ClF3IN4O |
| Molecular Weight | 562.85 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 1-[[2-(3-chlorophenyl)-1-methylpiperidin-3-yl]methyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC(F)(F)F)NCC1CCCN(C)C1c1cccc(Cl)c1.I |
| InChI | InChI=1S/C20H30ClF3N4O.HI/c1-25-19(26-9-5-11-29-14-20(22,23)24)27-13-16-7-4-10-28(2)18(16)15-6-3-8-17(21)12-15;/h3,6,8,12,16,18H,4-5,7,9-11,13-14H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | MVNIXBZUJXMBHK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|