C23H30FN7O — CID 111638388
1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111638388) has the molecular formula C23H30FN7O and a molecular weight of 439.54 g/mol. Its IUPAC name is 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111638388 |
| Molecular Formula | C23H30FN7O |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCC(=O)N1CCN(c2ncccn2)CC1)NCC1(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C23H30FN7O/c1-25-21(29-17-23(7-8-23)18-4-2-5-19(24)16-18)26-11-6-20(32)30-12-14-31(15-13-30)22-27-9-3-10-28-22/h2-5,9-10,16H,6-8,11-15,17H2,1H3,(H2,25,26,29) |
| InChIKey | HHGACRDVYJYIMQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|