C22H24N2O2 — CID 11163875
2-methoxy-4-[5-(1-phenylbutylamino)-3-pyridinyl]phenol (PubChem CID 11163875) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-methoxy-4-[5-(1-phenylbutylamino)-3-pyridinyl]phenol.
| Compound Name | 2-methoxy-4-[5-(1-phenylbutylamino)-3-pyridinyl]phenol |
|---|---|
| PubChem CID | 11163875 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-methoxy-4-[5-(1-phenylbutylamino)-3-pyridinyl]phenol |
| SMILES | CCCC(Nc1cncc(-c2ccc(O)c(OC)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2/c1-3-7-20(16-8-5-4-6-9-16)24-19-12-18(14-23-15-19)17-10-11-21(25)22(13-17)26-2/h4-6,8-15,20,24-25H,3,7H2,1-2H3 |
| InChIKey | PZCTXAXFFNZQQI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |