C30H44N4O2 — CID 159299405
6-[4-[4-(diethylamino)butoxy]-3-methoxyphenyl]-N-(1-phenylbutyl)pyrazin-2-amine;methane (PubChem CID 159299405) has the molecular formula C30H44N4O2 and a molecular weight of 492.71 g/mol. Its IUPAC name is 6-[4-[4-(diethylamino)butoxy]-3-methoxyphenyl]-N-(1-phenylbutyl)pyrazin-2-amine;methane.
| Compound Name | 6-[4-[4-(diethylamino)butoxy]-3-methoxyphenyl]-N-(1-phenylbutyl)pyrazin-2-amine;methane |
|---|---|
| PubChem CID | 159299405 |
| Molecular Formula | C30H44N4O2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | 6-[4-[4-(diethylamino)butoxy]-3-methoxyphenyl]-N-(1-phenylbutyl)pyrazin-2-amine;methane |
| SMILES | C.CCCC(Nc1cncc(-c2ccc(OCCCCN(CC)CC)c(OC)c2)n1)c1ccccc1 |
| InChI | InChI=1S/C29H40N4O2.CH4/c1-5-13-25(23-14-9-8-10-15-23)31-29-22-30-21-26(32-29)24-16-17-27(28(20-24)34-4)35-19-12-11-18-33(6-2)7-3;/h8-10,14-17,20-22,25H,5-7,11-13,18-19H2,1-4H3,(H,31,32);1H4 |
| InChIKey | LBDFXINWJNLJRA-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|