C20H17N3O2 — CID 164615408
2-[[6-(1-benzofuran-5-yl)pyrazin-2-yl]amino]-2-phenylethanol (PubChem CID 164615408) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-[[6-(1-benzofuran-5-yl)pyrazin-2-yl]amino]-2-phenylethanol.
| Compound Name | 2-[[6-(1-benzofuran-5-yl)pyrazin-2-yl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 164615408 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-[[6-(1-benzofuran-5-yl)pyrazin-2-yl]amino]-2-phenylethanol |
| SMILES | OCC(Nc1cncc(-c2ccc3occc3c2)n1)c1ccccc1 |
| InChI | InChI=1S/C20H17N3O2/c24-13-18(14-4-2-1-3-5-14)23-20-12-21-11-17(22-20)15-6-7-19-16(10-15)8-9-25-19/h1-12,18,24H,13H2,(H,22,23) |
| InChIKey | GZRCLUCDZDBXIH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |