C24H28N4O — CID 58496576
1-[4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]pentan-2-one (PubChem CID 58496576) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 1-[4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]pentan-2-one.
| Compound Name | 1-[4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]pentan-2-one |
|---|---|
| PubChem CID | 58496576 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 1-[4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]pentan-2-one |
| SMILES | CCCC(=O)Cc1ccc(-c2cncc(NC(CCC)c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C24H28N4O/c1-3-6-21(29)14-18-9-11-19(12-10-18)23-16-26-17-24(28-23)27-22(7-4-2)20-8-5-13-25-15-20/h5,8-13,15-17,22H,3-4,6-7,14H2,1-2H3,(H,27,28) |
| InChIKey | QFBVJCNAYWHDRA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |