C28H39N7O2 — CID 11352655
1-[3-(diethylamino)propyl]-3-[2-methoxy-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]urea (PubChem CID 11352655) has the molecular formula C28H39N7O2 and a molecular weight of 505.67 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-[2-methoxy-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]urea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-[2-methoxy-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 11352655 |
| Molecular Formula | C28H39N7O2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-[2-methoxy-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]urea |
| SMILES | CCCC(Nc1cncc(-c2ccc(NC(=O)NCCCN(CC)CC)c(OC)c2)n1)c1cccnc1 |
| InChI | InChI=1S/C28H39N7O2/c1-5-10-23(22-11-8-14-29-18-22)32-27-20-30-19-25(33-27)21-12-13-24(26(17-21)37-4)34-28(36)31-15-9-16-35(6-2)7-3/h8,11-14,17-20,23H,5-7,9-10,15-16H2,1-4H3,(H,32,33)(H2,31,34,36) |
| InChIKey | JOVRYLYMOKSZMO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|