C27H34N4O2 — CID 143056501
1-ethyl-3-[2-methoxy-4-[6-[(4R)-4-phenylheptyl]pyrazin-2-yl]phenyl]urea (PubChem CID 143056501) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 1-ethyl-3-[2-methoxy-4-[6-[(4R)-4-phenylheptyl]pyrazin-2-yl]phenyl]urea.
| Compound Name | 1-ethyl-3-[2-methoxy-4-[6-[(4R)-4-phenylheptyl]pyrazin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 143056501 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 1-ethyl-3-[2-methoxy-4-[6-[(4R)-4-phenylheptyl]pyrazin-2-yl]phenyl]urea |
| SMILES | CCC[C@H](CCCc1cncc(-c2ccc(NC(=O)NCC)c(OC)c2)n1)c1ccccc1 |
| InChI | InChI=1S/C27H34N4O2/c1-4-10-20(21-11-7-6-8-12-21)13-9-14-23-18-28-19-25(30-23)22-15-16-24(26(17-22)33-3)31-27(32)29-5-2/h6-8,11-12,15-20H,4-5,9-10,13-14H2,1-3H3,(H2,29,31,32)/t20-/m1/s1 |
| InChIKey | YMXWLVBKKOCNNX-HXUWFJFHSA-N |
| XLogP | 6.20 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |