C25H34N6O — CID 159365500
1-ethyl-3-[2-ethyl-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]urea;methane (PubChem CID 159365500) has the molecular formula C25H34N6O and a molecular weight of 434.59 g/mol. Its IUPAC name is 1-ethyl-3-[2-ethyl-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]urea;methane.
| Compound Name | 1-ethyl-3-[2-ethyl-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]urea;methane |
|---|---|
| PubChem CID | 159365500 |
| Molecular Formula | C25H34N6O |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 1-ethyl-3-[2-ethyl-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]urea;methane |
| SMILES | C.CCCC(Nc1cncc(-c2ccc(NC(=O)NCC)c(CC)c2)n1)c1cccnc1 |
| InChI | InChI=1S/C24H30N6O.CH4/c1-4-8-20(19-9-7-12-25-14-19)28-23-16-26-15-22(29-23)18-10-11-21(17(5-2)13-18)30-24(31)27-6-3;/h7,9-16,20H,4-6,8H2,1-3H3,(H,28,29)(H2,27,30,31);1H4 |
| InChIKey | LJBQNAAVAYTCLT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |