C28H37N5O — CID 11167065
N-[3-(diethylamino)propyl]-4-[6-(1-phenylbutylamino)pyrazin-2-yl]benzamide (PubChem CID 11167065) has the molecular formula C28H37N5O and a molecular weight of 459.64 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-4-[6-(1-phenylbutylamino)pyrazin-2-yl]benzamide.
| Compound Name | N-[3-(diethylamino)propyl]-4-[6-(1-phenylbutylamino)pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 11167065 |
| Molecular Formula | C28H37N5O |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | N-[3-(diethylamino)propyl]-4-[6-(1-phenylbutylamino)pyrazin-2-yl]benzamide |
| SMILES | CCCC(Nc1cncc(-c2ccc(C(=O)NCCCN(CC)CC)cc2)n1)c1ccccc1 |
| InChI | InChI=1S/C28H37N5O/c1-4-11-25(22-12-8-7-9-13-22)31-27-21-29-20-26(32-27)23-14-16-24(17-15-23)28(34)30-18-10-19-33(5-2)6-3/h7-9,12-17,20-21,25H,4-6,10-11,18-19H2,1-3H3,(H,30,34)(H,31,32) |
| InChIKey | DQPKRGKISAZMQD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|