C26H34N6O — CID 11316795
N-(5-aminopentyl)-2-methyl-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]benzamide (PubChem CID 11316795) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is N-(5-aminopentyl)-2-methyl-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]benzamide.
| Compound Name | N-(5-aminopentyl)-2-methyl-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 11316795 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | N-(5-aminopentyl)-2-methyl-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]benzamide |
| SMILES | CCCC(Nc1cncc(-c2ccc(C(=O)NCCCCCN)c(C)c2)n1)c1cccnc1 |
| InChI | InChI=1S/C26H34N6O/c1-3-8-23(21-9-7-13-28-16-21)31-25-18-29-17-24(32-25)20-10-11-22(19(2)15-20)26(33)30-14-6-4-5-12-27/h7,9-11,13,15-18,23H,3-6,8,12,14,27H2,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | MFFALQMXQVXOCC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|