C23H33FN6 — CID 111638898
1-ethyl-2-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine (PubChem CID 111638898) has the molecular formula C23H33FN6 and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111638898 |
| Molecular Formula | C23H33FN6 |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 1-ethyl-2-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2cccc(F)c2)CC1)NCCCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C23H33FN6/c1-2-25-22(27-17-23(12-13-23)18-8-6-9-19(24)16-18)26-14-7-11-21-29-28-20-10-4-3-5-15-30(20)21/h6,8-9,16H,2-5,7,10-15,17H2,1H3,(H2,25,26,27) |
| InChIKey | WVQCMNWXPZLQMS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|