C17H24FN3S — CID 111639544
1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-(2-prop-2-enylsulfanylethyl)guanidine (PubChem CID 111639544) has the molecular formula C17H24FN3S and a molecular weight of 321.47 g/mol. Its IUPAC name is 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-(2-prop-2-enylsulfanylethyl)guanidine.
| Compound Name | 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-(2-prop-2-enylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111639544 |
| Molecular Formula | C17H24FN3S |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-(2-prop-2-enylsulfanylethyl)guanidine |
| SMILES | C=CCSCCN/C(=N\C)NCC1(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H24FN3S/c1-3-10-22-11-9-20-16(19-2)21-13-17(7-8-17)14-5-4-6-15(18)12-14/h3-6,12H,1,7-11,13H2,2H3,(H2,19,20,21) |
| InChIKey | ZAGNTALRILFZAY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|