C21H24FIN6 — CID 111639551
1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111639551) has the molecular formula C21H24FIN6 and a molecular weight of 506.37 g/mol. Its IUPAC name is 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111639551 |
| Molecular Formula | C21H24FIN6 |
| Molecular Weight | 506.37 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccnc(-n2ccnc2)c1)NCC1(c2cccc(F)c2)CC1.I |
| InChI | InChI=1S/C21H23FN6.HI/c1-23-20(27-14-21(6-7-21)17-3-2-4-18(22)12-17)26-13-16-5-8-25-19(11-16)28-10-9-24-15-28;/h2-5,8-12,15H,6-7,13-14H2,1H3,(H2,23,26,27);1H |
| InChIKey | RYLSBBVADVNVML-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|