C20H29ClN4O — CID 111639810
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[[1-(3-chlorophenyl)cyclopropyl]methyl]-2-methylguanidine (PubChem CID 111639810) has the molecular formula C20H29ClN4O and a molecular weight of 376.93 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[[1-(3-chlorophenyl)cyclopropyl]methyl]-2-methylguanidine.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[[1-(3-chlorophenyl)cyclopropyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111639810 |
| Molecular Formula | C20H29ClN4O |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[[1-(3-chlorophenyl)cyclopropyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCC1CN2CCCC2CO1)NCC1(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H29ClN4O/c1-22-19(23-11-18-12-25-9-3-6-17(25)13-26-18)24-14-20(7-8-20)15-4-2-5-16(21)10-15/h2,4-5,10,17-18H,3,6-9,11-14H2,1H3,(H2,22,23,24) |
| InChIKey | DCLSQUZJCKTCDN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|