C17H22N6O3 — CID 11164204
1-[[4-amino-1-(2-hydroxy-2-methylpropyl)imidazo[4,5-c]quinolin-2-yl]methoxy]-3-methylurea (PubChem CID 11164204) has the molecular formula C17H22N6O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-[[4-amino-1-(2-hydroxy-2-methylpropyl)imidazo[4,5-c]quinolin-2-yl]methoxy]-3-methylurea.
| Compound Name | 1-[[4-amino-1-(2-hydroxy-2-methylpropyl)imidazo[4,5-c]quinolin-2-yl]methoxy]-3-methylurea |
|---|---|
| PubChem CID | 11164204 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1-[[4-amino-1-(2-hydroxy-2-methylpropyl)imidazo[4,5-c]quinolin-2-yl]methoxy]-3-methylurea |
| SMILES | CNC(=O)NOCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)O |
| InChI | InChI=1S/C17H22N6O3/c1-17(2,25)9-23-12(8-26-22-16(24)19-3)21-13-14(23)10-6-4-5-7-11(10)20-15(13)18/h4-7,25H,8-9H2,1-3H3,(H2,18,20)(H2,19,22,24) |
| InChIKey | NVGHAHMFXPAEOJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|