C28H34N6O4S — CID 11656870
1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-ol;1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea (PubChem CID 11656870) has the molecular formula C28H34N6O4S and a molecular weight of 550.69 g/mol. Its IUPAC name is 1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-ol;1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea.
| Compound Name | 1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-ol;1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 11656870 |
| Molecular Formula | C28H34N6O4S |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-ol;1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea |
| SMILES | CC(c1cc2ccccc2s1)N(O)C(N)=O.CCOCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)O |
| InChI | InChI=1S/C17H22N4O2.C11H12N2O2S/c1-4-23-9-13-20-14-15(21(13)10-17(2,3)22)11-7-5-6-8-12(11)19-16(14)18;1-7(13(15)11(12)14)10-6-8-4-2-3-5-9(8)16-10/h5-8,22H,4,9-10H2,1-3H3,(H2,18,19);2-7,15H,1H3,(H2,12,14) |
| InChIKey | JWZNQYINMGOFMC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 152.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|