C19H22F2N4O — CID 11164276
(E)-1-(3,5-difluorophenyl)-N-methoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine (PubChem CID 11164276) has the molecular formula C19H22F2N4O and a molecular weight of 360.41 g/mol. Its IUPAC name is (E)-1-(3,5-difluorophenyl)-N-methoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine.
| Compound Name | (E)-1-(3,5-difluorophenyl)-N-methoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine |
|---|---|
| PubChem CID | 11164276 |
| Molecular Formula | C19H22F2N4O |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (E)-1-(3,5-difluorophenyl)-N-methoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine |
| SMILES | CO/N=C(\CCN1CCN(c2ccccn2)CC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C19H22F2N4O/c1-26-23-18(15-12-16(20)14-17(21)13-15)5-7-24-8-10-25(11-9-24)19-4-2-3-6-22-19/h2-4,6,12-14H,5,7-11H2,1H3/b23-18+ |
| InChIKey | DWXTXKLKQKWXGL-PTGBLXJZSA-N |
| XLogP | 2.92 |
| TPSA | 40.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|