C26H38IN3O3 — CID 111643343
2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[[4-(phenylmethoxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111643343) has the molecular formula C26H38IN3O3 and a molecular weight of 567.51 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[[4-(phenylmethoxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[[4-(phenylmethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111643343 |
| Molecular Formula | C26H38IN3O3 |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[[4-(phenylmethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCOCC1)NCc1ccc(COCc2ccccc2)cc1.I |
| InChI | InChI=1S/C26H37N3O3.HI/c1-27-26(28-14-5-15-31-19-25-12-16-30-17-13-25)29-18-22-8-10-24(11-9-22)21-32-20-23-6-3-2-4-7-23;/h2-4,6-11,25H,5,12-21H2,1H3,(H2,27,28,29);1H |
| InChIKey | YFYHESUWAJOEPX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|