C18H29BrIN3O2 — CID 111977687
1-[(4-bromophenyl)methyl]-2-methyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111977687) has the molecular formula C18H29BrIN3O2 and a molecular weight of 526.26 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-2-methyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-bromophenyl)methyl]-2-methyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111977687 |
| Molecular Formula | C18H29BrIN3O2 |
| Molecular Weight | 526.26 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-2-methyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCOCC1)NCc1ccc(Br)cc1.I |
| InChI | InChI=1S/C18H28BrN3O2.HI/c1-20-18(22-13-15-3-5-17(19)6-4-15)21-9-2-10-24-14-16-7-11-23-12-8-16;/h3-6,16H,2,7-14H2,1H3,(H2,20,21,22);1H |
| InChIKey | RUACEJIHHZPHGQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|