C18H30N4O4S — CID 111641986
2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[(4-sulfamoylphenyl)methyl]guanidine (PubChem CID 111641986) has the molecular formula C18H30N4O4S and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[(4-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[(4-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111641986 |
| Molecular Formula | C18H30N4O4S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[(4-sulfamoylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCCCOCC1CCOCC1)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H30N4O4S/c1-20-18(21-9-2-10-26-14-16-7-11-25-12-8-16)22-13-15-3-5-17(6-4-15)27(19,23)24/h3-6,16H,2,7-14H2,1H3,(H2,19,23,24)(H2,20,21,22) |
| InChIKey | ZPTCFIAZUSRBBH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|