C18H16FN7O — CID 11164422
1-ethyl-3-(5-fluoro-4-pyrazol-1-yl-6-pyridin-3-yl-1H-benzimidazol-2-yl)urea (PubChem CID 11164422) has the molecular formula C18H16FN7O and a molecular weight of 365.37 g/mol. Its IUPAC name is 1-ethyl-3-(5-fluoro-4-pyrazol-1-yl-6-pyridin-3-yl-1H-benzimidazol-2-yl)urea.
| Compound Name | 1-ethyl-3-(5-fluoro-4-pyrazol-1-yl-6-pyridin-3-yl-1H-benzimidazol-2-yl)urea |
|---|---|
| PubChem CID | 11164422 |
| Molecular Formula | C18H16FN7O |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-ethyl-3-(5-fluoro-4-pyrazol-1-yl-6-pyridin-3-yl-1H-benzimidazol-2-yl)urea |
| SMILES | CCNC(=O)Nc1nc2c(-n3cccn3)c(F)c(-c3cccnc3)cc2[nH]1 |
| InChI | InChI=1S/C18H16FN7O/c1-2-21-18(27)25-17-23-13-9-12(11-5-3-6-20-10-11)14(19)16(15(13)24-17)26-8-4-7-22-26/h3-10H,2H2,1H3,(H3,21,23,24,25,27) |
| InChIKey | BIXFNTORBPCGRA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |