C19H16FN7O — CID 11494578
1-ethyl-3-[6-(5-fluoro-3-pyridinyl)-4-pyrimidin-2-yl-1H-benzimidazol-2-yl]urea (PubChem CID 11494578) has the molecular formula C19H16FN7O and a molecular weight of 377.38 g/mol. Its IUPAC name is 1-ethyl-3-[6-(5-fluoro-3-pyridinyl)-4-pyrimidin-2-yl-1H-benzimidazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[6-(5-fluoro-3-pyridinyl)-4-pyrimidin-2-yl-1H-benzimidazol-2-yl]urea |
|---|---|
| PubChem CID | 11494578 |
| Molecular Formula | C19H16FN7O |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1-ethyl-3-[6-(5-fluoro-3-pyridinyl)-4-pyrimidin-2-yl-1H-benzimidazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2c(-c3ncccn3)cc(-c3cncc(F)c3)cc2[nH]1 |
| InChI | InChI=1S/C19H16FN7O/c1-2-22-19(28)27-18-25-15-8-11(12-6-13(20)10-21-9-12)7-14(16(15)26-18)17-23-4-3-5-24-17/h3-10H,2H2,1H3,(H3,22,25,26,27,28) |
| InChIKey | FKCGKEHVIVGGDU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |