C20H20N8O — CID 16718075
1-ethyl-3-[6-(pyridin-2-ylmethylamino)-4-pyrimidin-2-yl-1H-benzimidazol-2-yl]urea (PubChem CID 16718075) has the molecular formula C20H20N8O and a molecular weight of 388.44 g/mol. Its IUPAC name is 1-ethyl-3-[6-(pyridin-2-ylmethylamino)-4-pyrimidin-2-yl-1H-benzimidazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[6-(pyridin-2-ylmethylamino)-4-pyrimidin-2-yl-1H-benzimidazol-2-yl]urea |
|---|---|
| PubChem CID | 16718075 |
| Molecular Formula | C20H20N8O |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-ethyl-3-[6-(pyridin-2-ylmethylamino)-4-pyrimidin-2-yl-1H-benzimidazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2c(-c3ncccn3)cc(NCc3ccccn3)cc2[nH]1 |
| InChI | InChI=1S/C20H20N8O/c1-2-21-20(29)28-19-26-16-11-14(25-12-13-6-3-4-7-22-13)10-15(17(16)27-19)18-23-8-5-9-24-18/h3-11,25H,2,12H2,1H3,(H3,21,26,27,28,29) |
| InChIKey | YGXOEXJZSLJBHS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |