C24H26N8O — CID 163806183
1-ethyl-3-[6-[6-(2-methyl-1-methyliminopropan-2-yl)-3-pyridinyl]-4-pyrimidin-2-yl-1H-benzimidazol-2-yl]urea (PubChem CID 163806183) has the molecular formula C24H26N8O and a molecular weight of 442.53 g/mol. Its IUPAC name is 1-ethyl-3-[6-[6-(2-methyl-1-methyliminopropan-2-yl)-3-pyridinyl]-4-pyrimidin-2-yl-1H-benzimidazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[6-[6-(2-methyl-1-methyliminopropan-2-yl)-3-pyridinyl]-4-pyrimidin-2-yl-1H-benzimidazol-2-yl]urea |
|---|---|
| PubChem CID | 163806183 |
| Molecular Formula | C24H26N8O |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 1-ethyl-3-[6-[6-(2-methyl-1-methyliminopropan-2-yl)-3-pyridinyl]-4-pyrimidin-2-yl-1H-benzimidazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2c(-c3ncccn3)cc(-c3ccc(C(C)(C)/C=N/C)nc3)cc2[nH]1 |
| InChI | InChI=1S/C24H26N8O/c1-5-26-23(33)32-22-30-18-12-16(11-17(20(18)31-22)21-27-9-6-10-28-21)15-7-8-19(29-13-15)24(2,3)14-25-4/h6-14H,5H2,1-4H3,(H3,26,30,31,32,33)/b25-14+ |
| InChIKey | NJFWSSZBOCBDGH-AFUMVMLFSA-N |
| XLogP | 4.20 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|