C15H14BN5O — CID 89324885
CID 89324885 (PubChem CID 89324885) has the molecular formula C15H14BN5O and a molecular weight of 291.12 g/mol.
| Compound Name | CID 89324885 |
|---|---|
| PubChem CID | 89324885 |
| Molecular Formula | C15H14BN5O |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | — |
| SMILES | [B]c1cc(-c2cccnc2)cc2[nH]c(NC(=O)NCC)nc12 |
| InChI | InChI=1S/C15H14BN5O/c1-2-18-15(22)21-14-19-12-7-10(6-11(16)13(12)20-14)9-4-3-5-17-8-9/h3-8H,2H2,1H3,(H3,18,19,20,21,22) |
| InChIKey | BAADEVALGRNABJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|