C21H24N6O2 — CID 90785547
1-[4-(C-cyclopropyl-N-ethoxycarbonimidoyl)-6-pyridin-3-yl-1H-benzimidazol-2-yl]-3-ethylurea (PubChem CID 90785547) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-[4-(C-cyclopropyl-N-ethoxycarbonimidoyl)-6-pyridin-3-yl-1H-benzimidazol-2-yl]-3-ethylurea.
| Compound Name | 1-[4-(C-cyclopropyl-N-ethoxycarbonimidoyl)-6-pyridin-3-yl-1H-benzimidazol-2-yl]-3-ethylurea |
|---|---|
| PubChem CID | 90785547 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 1-[4-(C-cyclopropyl-N-ethoxycarbonimidoyl)-6-pyridin-3-yl-1H-benzimidazol-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2c(C(=NOCC)C3CC3)cc(-c3cccnc3)cc2[nH]1 |
| InChI | InChI=1S/C21H24N6O2/c1-3-23-21(28)26-20-24-17-11-15(14-6-5-9-22-12-14)10-16(19(17)25-20)18(13-7-8-13)27-29-4-2/h5-6,9-13H,3-4,7-8H2,1-2H3,(H3,23,24,25,26,28) |
| InChIKey | LPBLOYUIFOAMTL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|