C21H21N7O2 — CID 10318992
1-ethyl-3-[4-(1-ethylimidazole-2-carbonyl)-6-pyridin-3-yl-1H-benzimidazol-2-yl]urea (PubChem CID 10318992) has the molecular formula C21H21N7O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is 1-ethyl-3-[4-(1-ethylimidazole-2-carbonyl)-6-pyridin-3-yl-1H-benzimidazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[4-(1-ethylimidazole-2-carbonyl)-6-pyridin-3-yl-1H-benzimidazol-2-yl]urea |
|---|---|
| PubChem CID | 10318992 |
| Molecular Formula | C21H21N7O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-ethyl-3-[4-(1-ethylimidazole-2-carbonyl)-6-pyridin-3-yl-1H-benzimidazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2c(C(=O)c3nccn3CC)cc(-c3cccnc3)cc2[nH]1 |
| InChI | InChI=1S/C21H21N7O2/c1-3-23-21(30)27-20-25-16-11-14(13-6-5-7-22-12-13)10-15(17(16)26-20)18(29)19-24-8-9-28(19)4-2/h5-12H,3-4H2,1-2H3,(H3,23,25,26,27,30) |
| InChIKey | KEVSFYDWHSYZKF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |