C22H38IN5O3 — CID 111644923
2-methyl-1-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111644923) has the molecular formula C22H38IN5O3 and a molecular weight of 547.48 g/mol. Its IUPAC name is 2-methyl-1-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111644923 |
| Molecular Formula | C22H38IN5O3 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 2-methyl-1-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCOCC1)NCc1ccc(N2CCOC(C)C2)nc1.I |
| InChI | InChI=1S/C22H37N5O3.HI/c1-18-16-27(9-13-30-18)21-5-4-20(14-25-21)15-26-22(23-2)24-8-3-10-29-17-19-6-11-28-12-7-19;/h4-5,14,18-19H,3,6-13,15-17H2,1-2H3,(H2,23,24,26);1H |
| InChIKey | AUAWRZXHSSDRIB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|