C22H35N3O4 — CID 111645638
1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine (PubChem CID 111645638) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine.
| Compound Name | 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111645638 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 1-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine |
| SMILES | CCOc1cc2c(cc1CN/C(=N/C)NCCCOCC1CCOC1)OC(C)C2 |
| InChI | InChI=1S/C22H35N3O4/c1-4-28-20-11-18-10-16(2)29-21(18)12-19(20)13-25-22(23-3)24-7-5-8-26-14-17-6-9-27-15-17/h11-12,16-17H,4-10,13-15H2,1-3H3,(H2,23,24,25) |
| InChIKey | OPLPEHXOIOXJOE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|