C19H32IN3O3 — CID 111645773
1-[(3-methoxy-4-methylphenyl)methyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111645773) has the molecular formula C19H32IN3O3 and a molecular weight of 477.39 g/mol. Its IUPAC name is 1-[(3-methoxy-4-methylphenyl)methyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-methoxy-4-methylphenyl)methyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111645773 |
| Molecular Formula | C19H32IN3O3 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 1-[(3-methoxy-4-methylphenyl)methyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCOC1)NCc1ccc(C)c(OC)c1.I |
| InChI | InChI=1S/C19H31N3O3.HI/c1-15-5-6-16(11-18(15)23-3)12-22-19(20-2)21-8-4-9-24-13-17-7-10-25-14-17;/h5-6,11,17H,4,7-10,12-14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | WYDDWFQQBMWEMQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|