C16H26ClIN4O2 — CID 111646959
1-[(6-chloro-3-pyridinyl)methyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111646959) has the molecular formula C16H26ClIN4O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111646959 |
| Molecular Formula | C16H26ClIN4O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-2-methyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCOC1)NCc1ccc(Cl)nc1.I |
| InChI | InChI=1S/C16H25ClN4O2.HI/c1-18-16(21-10-13-3-4-15(17)20-9-13)19-6-2-7-22-11-14-5-8-23-12-14;/h3-4,9,14H,2,5-8,10-12H2,1H3,(H2,18,19,21);1H |
| InChIKey | XSPNMRAMFKNKFV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|