C18H36O6Si — CID 11164773
ethyl (E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)hex-2-enoate (PubChem CID 11164773) has the molecular formula C18H36O6Si and a molecular weight of 376.57 g/mol. Its IUPAC name is ethyl (E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)hex-2-enoate.
| Compound Name | ethyl (E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)hex-2-enoate |
|---|---|
| PubChem CID | 11164773 |
| Molecular Formula | C18H36O6Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | ethyl (E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)hex-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](OCOCCOC)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O6Si/c1-9-22-17(19)11-10-16(23-14-21-13-12-20-6)15(2)24-25(7,8)18(3,4)5/h10-11,15-16H,9,12-14H2,1-8H3/b11-10+/t15-,16+/m0/s1 |
| InChIKey | HAFFGSUWWVAQRO-ZBYDSPNZSA-N |
| XLogP | 3.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|