C19H29F3N4O3 — CID 111647810
1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine (PubChem CID 111647810) has the molecular formula C19H29F3N4O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111647810 |
| Molecular Formula | C19H29F3N4O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(OCC(F)(F)F)c1)NCCCOCC1CCOC1 |
| InChI | InChI=1S/C19H29F3N4O3/c1-2-23-18(25-6-3-8-27-12-16-5-9-28-13-16)26-11-15-4-7-24-17(10-15)29-14-19(20,21)22/h4,7,10,16H,2-3,5-6,8-9,11-14H2,1H3,(H2,23,25,26) |
| InChIKey | ZOMUQSPLTRTDFI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|