C24H35N7O — CID 111649150
1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111649150) has the molecular formula C24H35N7O and a molecular weight of 437.59 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111649150 |
| Molecular Formula | C24H35N7O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | 1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCC(=O)N1CCN(c2ncccn2)CC1)NCCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C24H35N7O/c1-4-25-23(26-10-6-21-17-19(2)16-20(3)18-21)27-11-7-22(32)30-12-14-31(15-13-30)24-28-8-5-9-29-24/h5,8-9,16-18H,4,6-7,10-15H2,1-3H3,(H2,25,26,27) |
| InChIKey | MUDVKZRFCBTRFM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|