C21H37N7O — CID 111194852
1-ethyl-3-heptan-2-yl-2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111194852) has the molecular formula C21H37N7O and a molecular weight of 403.58 g/mol. Its IUPAC name is 1-ethyl-3-heptan-2-yl-2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-heptan-2-yl-2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111194852 |
| Molecular Formula | C21H37N7O |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | 1-ethyl-3-heptan-2-yl-2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCCCCC(C)N/C(=N/CCC(=O)N1CCN(c2ncccn2)CC1)NCC |
| InChI | InChI=1S/C21H37N7O/c1-4-6-7-9-18(3)26-20(22-5-2)23-13-10-19(29)27-14-16-28(17-15-27)21-24-11-8-12-25-21/h8,11-12,18H,4-7,9-10,13-17H2,1-3H3,(H2,22,23,26) |
| InChIKey | WUHAUGGWNYXBFD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|