C21H37N5 — CID 111649262
1-[2-(3,5-dimethylphenyl)ethyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine (PubChem CID 111649262) has the molecular formula C21H37N5 and a molecular weight of 359.56 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenyl)ethyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(3,5-dimethylphenyl)ethyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111649262 |
| Molecular Formula | C21H37N5 |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.30 |
| IUPAC Name | 1-[2-(3,5-dimethylphenyl)ethyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCN1CCCN(C)CC1)NCCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C21H37N5/c1-18-15-19(2)17-20(16-18)7-9-24-21(22-3)23-8-5-11-26-12-6-10-25(4)13-14-26/h15-17H,5-14H2,1-4H3,(H2,22,23,24) |
| InChIKey | JVFNQTRTKFURON-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|