C18H26BrN3O — CID 111650062
2-[[1-(2-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-(oxolan-2-ylmethyl)guanidine (PubChem CID 111650062) has the molecular formula C18H26BrN3O and a molecular weight of 380.33 g/mol. Its IUPAC name is 2-[[1-(2-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 2-[[1-(2-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111650062 |
| Molecular Formula | C18H26BrN3O |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-[[1-(2-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-(oxolan-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CC1(c2ccccc2Br)CC1)NCC1CCCO1 |
| InChI | InChI=1S/C18H26BrN3O/c1-2-20-17(21-12-14-6-5-11-23-14)22-13-18(9-10-18)15-7-3-4-8-16(15)19/h3-4,7-8,14H,2,5-6,9-13H2,1H3,(H2,20,21,22) |
| InChIKey | VQBZPOMYDUKJCO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|