C15H22BrN3O — CID 111986469
2-[[1-(2-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-(2-hydroxyethyl)guanidine (PubChem CID 111986469) has the molecular formula C15H22BrN3O and a molecular weight of 340.27 g/mol. Its IUPAC name is 2-[[1-(2-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-(2-hydroxyethyl)guanidine.
| Compound Name | 2-[[1-(2-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-(2-hydroxyethyl)guanidine |
|---|---|
| PubChem CID | 111986469 |
| Molecular Formula | C15H22BrN3O |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[[1-(2-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-(2-hydroxyethyl)guanidine |
| SMILES | CCN/C(=N\CC1(c2ccccc2Br)CC1)NCCO |
| InChI | InChI=1S/C15H22BrN3O/c1-2-17-14(18-9-10-20)19-11-15(7-8-15)12-5-3-4-6-13(12)16/h3-6,20H,2,7-11H2,1H3,(H2,17,18,19) |
| InChIKey | YULVQHXMQUEKTF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|