C22H17N3O2S — CID 11165115
4-[(4-nitrophenyl)methylsulfanyl]-2,5-diphenyl-1H-imidazole (PubChem CID 11165115) has the molecular formula C22H17N3O2S and a molecular weight of 387.46 g/mol. Its IUPAC name is 4-[(4-nitrophenyl)methylsulfanyl]-2,5-diphenyl-1H-imidazole.
| Compound Name | 4-[(4-nitrophenyl)methylsulfanyl]-2,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 11165115 |
| Molecular Formula | C22H17N3O2S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 4-[(4-nitrophenyl)methylsulfanyl]-2,5-diphenyl-1H-imidazole |
| SMILES | O=[N+]([O-])c1ccc(CSc2nc(-c3ccccc3)[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H17N3O2S/c26-25(27)19-13-11-16(12-14-19)15-28-22-20(17-7-3-1-4-8-17)23-21(24-22)18-9-5-2-6-10-18/h1-14H,15H2,(H,23,24) |
| InChIKey | YTVNXEOKTPBBSU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|