C18H36IN5OS — CID 111651513
1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111651513) has the molecular formula C18H36IN5OS and a molecular weight of 497.49 g/mol. Its IUPAC name is 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111651513 |
| Molecular Formula | C18H36IN5OS |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[4-(4-methyl-1,3-thiazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCc1nc(C)cs1)NCCN(C)CCCOC.I |
| InChI | InChI=1S/C18H35N5OS.HI/c1-5-19-18(21-11-13-23(3)12-8-14-24-4)20-10-7-6-9-17-22-16(2)15-25-17;/h15H,5-14H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | QNTZWSYGAPHBJK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|