C20H34IN5OS2 — CID 111652463
1-ethyl-2-[2-[3-methoxypropyl(methyl)amino]ethyl]-3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111652463) has the molecular formula C20H34IN5OS2 and a molecular weight of 551.56 g/mol. Its IUPAC name is 1-ethyl-2-[2-[3-methoxypropyl(methyl)amino]ethyl]-3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-[3-methoxypropyl(methyl)amino]ethyl]-3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111652463 |
| Molecular Formula | C20H34IN5OS2 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 1-ethyl-2-[2-[3-methoxypropyl(methyl)amino]ethyl]-3-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)CCCOC)NCCc1ccc(-c2csc(C)n2)s1.I |
| InChI | InChI=1S/C20H33N5OS2.HI/c1-5-21-20(23-11-13-25(3)12-6-14-26-4)22-10-9-17-7-8-19(28-17)18-15-27-16(2)24-18;/h7-8,15H,5-6,9-14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | ZAJZZQZAAZUKPS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|