C15H35N5O3S — CID 111651576
1-ethyl-2-[3-(ethylsulfonylamino)propyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine (PubChem CID 111651576) has the molecular formula C15H35N5O3S and a molecular weight of 365.54 g/mol. Its IUPAC name is 1-ethyl-2-[3-(ethylsulfonylamino)propyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[3-(ethylsulfonylamino)propyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111651576 |
| Molecular Formula | C15H35N5O3S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 1-ethyl-2-[3-(ethylsulfonylamino)propyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCCNS(=O)(=O)CC)NCCN(C)CCCOC |
| InChI | InChI=1S/C15H35N5O3S/c1-5-16-15(17-9-7-10-19-24(21,22)6-2)18-11-13-20(3)12-8-14-23-4/h19H,5-14H2,1-4H3,(H2,16,17,18) |
| InChIKey | PPIHOZJUBZPTRP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|