C18H36N6O — CID 111651828
1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine (PubChem CID 111651828) has the molecular formula C18H36N6O and a molecular weight of 352.53 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111651828 |
| Molecular Formula | C18H36N6O |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN(C)CCCOC)NCC(C)Cn1nc(C)cc1C |
| InChI | InChI=1S/C18H36N6O/c1-15(14-24-17(3)12-16(2)22-24)13-21-18(19-4)20-8-10-23(5)9-7-11-25-6/h12,15H,7-11,13-14H2,1-6H3,(H2,19,20,21) |
| InChIKey | OCRXOXYGOKSZBJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|